(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 1-(3-chloro-4-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 1-(3-chloro-4-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 1-(3-chloro-4-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | F152-0177 |
| Compound Name: | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 1-(3-chloro-4-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 438.87 |
| Molecular Formula: | C22 H19 Cl N4 O4 |
| Smiles: | Cc1c(C(=O)OCc2c(C)oc(c3ccccc3)n2)nnn1c1ccc(c(c1)[Cl])OC |
| Stereo: | ACHIRAL |
| logP: | 3.7501 |
| logD: | 3.7501 |
| logSw: | -4.1554 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 73.692 |
| InChI Key: | GLGDAMCUTBQLOJ-UHFFFAOYSA-N |