(3-fluorophenyl)methyl 1-(3,5-dimethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
(3-fluorophenyl)methyl 1-(3,5-dimethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
(3-fluorophenyl)methyl 1-(3,5-dimethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | F152-0409 |
| Compound Name: | (3-fluorophenyl)methyl 1-(3,5-dimethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 339.37 |
| Molecular Formula: | C19 H18 F N3 O2 |
| Smiles: | Cc1cc(C)cc(c1)n1c(C)c(C(=O)OCc2cccc(c2)F)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.1566 |
| logD: | 4.1566 |
| logSw: | -4.4804 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.939 |
| InChI Key: | XYVCYKIQUCVLSQ-UHFFFAOYSA-N |