(2-methylphenyl)methyl 1-(3,5-dimethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
(2-methylphenyl)methyl 1-(3,5-dimethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
(2-methylphenyl)methyl 1-(3,5-dimethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | F152-0412 |
| Compound Name: | (2-methylphenyl)methyl 1-(3,5-dimethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 335.4 |
| Molecular Formula: | C20 H21 N3 O2 |
| Smiles: | Cc1cc(C)cc(c1)n1c(C)c(C(=O)OCc2ccccc2C)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.565 |
| logD: | 4.565 |
| logSw: | -4.419 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.939 |
| InChI Key: | ICKPIDHPTJJILX-UHFFFAOYSA-N |