[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl 1-(4-ethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl 1-(4-ethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl 1-(4-ethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | F152-0485 |
| Compound Name: | [2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl 1-(4-ethylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 436.9 |
| Molecular Formula: | C23 H21 Cl N4 O3 |
| Smiles: | CCc1ccc(cc1)n1c(C)c(C(=O)OCc2c(C)oc(c3cccc(c3)[Cl])n2)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.9981 |
| logD: | 4.9981 |
| logSw: | -5.1959 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 66.061 |
| InChI Key: | WLMDDJSTIPSWNF-UHFFFAOYSA-N |