(3-chlorophenyl)methyl 1-(2-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
(3-chlorophenyl)methyl 1-(2-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
(3-chlorophenyl)methyl 1-(2-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | F152-0523 |
| Compound Name: | (3-chlorophenyl)methyl 1-(2-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 357.79 |
| Molecular Formula: | C18 H16 Cl N3 O3 |
| Smiles: | Cc1c(C(=O)OCc2cccc(c2)[Cl])nnn1c1ccccc1OC |
| Stereo: | ACHIRAL |
| logP: | 3.5041 |
| logD: | 3.5041 |
| logSw: | -3.7268 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.269 |
| InChI Key: | UYIGYIAWUXTVNC-UHFFFAOYSA-N |