6-[4-chloro-3-(4-methylpiperazine-1-sulfonyl)phenyl]pyridazin-3(2H)-one
Chemical Structure Depiction of
6-[4-chloro-3-(4-methylpiperazine-1-sulfonyl)phenyl]pyridazin-3(2H)-one
6-[4-chloro-3-(4-methylpiperazine-1-sulfonyl)phenyl]pyridazin-3(2H)-one
Compound characteristics
| Compound ID: | F153-0547 |
| Compound Name: | 6-[4-chloro-3-(4-methylpiperazine-1-sulfonyl)phenyl]pyridazin-3(2H)-one |
| Molecular Weight: | 368.84 |
| Molecular Formula: | C15 H17 Cl N4 O3 S |
| Smiles: | CN1CCN(CC1)S(c1cc(ccc1[Cl])C1C=CC(NN=1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4806 |
| logD: | 1.4164 |
| logSw: | -2.9502 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.563 |
| InChI Key: | BBFKSWWQAPHUIQ-UHFFFAOYSA-N |