N-(butan-2-yl)-4-[(2-{[(4-chlorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)methyl]benzamide
Chemical Structure Depiction of
N-(butan-2-yl)-4-[(2-{[(4-chlorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)methyl]benzamide
N-(butan-2-yl)-4-[(2-{[(4-chlorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)methyl]benzamide
Compound characteristics
| Compound ID: | F154-0052 |
| Compound Name: | N-(butan-2-yl)-4-[(2-{[(4-chlorophenyl)methyl]sulfanyl}-3H-imidazo[4,5-c]pyridin-3-yl)methyl]benzamide |
| Molecular Weight: | 465.02 |
| Molecular Formula: | C25 H25 Cl N4 O S |
| Smiles: | CCC(C)NC(c1ccc(Cn2c3cnccc3nc2SCc2ccc(cc2)[Cl])cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9352 |
| logD: | 4.9321 |
| logSw: | -5.0439 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.121 |
| InChI Key: | KPBSAULPLGZIPR-KRWDZBQOSA-N |