3-(5,6-dimethyl-4-oxofuro[2,3-d]pyrimidin-3(4H)-yl)-N-[(4-ethoxyphenyl)methyl]propanamide
Chemical Structure Depiction of
3-(5,6-dimethyl-4-oxofuro[2,3-d]pyrimidin-3(4H)-yl)-N-[(4-ethoxyphenyl)methyl]propanamide
3-(5,6-dimethyl-4-oxofuro[2,3-d]pyrimidin-3(4H)-yl)-N-[(4-ethoxyphenyl)methyl]propanamide
Compound characteristics
| Compound ID: | F160-1370 |
| Compound Name: | 3-(5,6-dimethyl-4-oxofuro[2,3-d]pyrimidin-3(4H)-yl)-N-[(4-ethoxyphenyl)methyl]propanamide |
| Molecular Weight: | 369.42 |
| Molecular Formula: | C20 H23 N3 O4 |
| Smiles: | CCOc1ccc(CNC(CCN2C=Nc3c(C2=O)c(C)c(C)o3)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.9216 |
| logD: | 1.9216 |
| logSw: | -2.3564 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.295 |
| InChI Key: | NISHOYBPVNJVQV-UHFFFAOYSA-N |