N-{5-(ethanesulfonyl)-2-[(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methoxy]phenyl}-3-methylbenzamide
Chemical Structure Depiction of
N-{5-(ethanesulfonyl)-2-[(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methoxy]phenyl}-3-methylbenzamide
N-{5-(ethanesulfonyl)-2-[(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methoxy]phenyl}-3-methylbenzamide
Compound characteristics
| Compound ID: | F172-0797 |
| Compound Name: | N-{5-(ethanesulfonyl)-2-[(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methoxy]phenyl}-3-methylbenzamide |
| Molecular Weight: | 481.53 |
| Molecular Formula: | C24 H23 N3 O6 S |
| Smiles: | CCS(c1ccc(c(c1)NC(c1cccc(C)c1)=O)OCC1=CC(N2C(C=C(C)O2)=N1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9807 |
| logD: | 1.8164 |
| logSw: | -2.7733 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 97.446 |
| InChI Key: | RGTNPXWCUHRPJG-UHFFFAOYSA-N |