N-{5-(ethanesulfonyl)-2-[(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methoxy]phenyl}-3-phenylprop-2-enamide
Chemical Structure Depiction of
N-{5-(ethanesulfonyl)-2-[(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methoxy]phenyl}-3-phenylprop-2-enamide
N-{5-(ethanesulfonyl)-2-[(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methoxy]phenyl}-3-phenylprop-2-enamide
Compound characteristics
| Compound ID: | F172-0868 |
| Compound Name: | N-{5-(ethanesulfonyl)-2-[(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methoxy]phenyl}-3-phenylprop-2-enamide |
| Molecular Weight: | 493.54 |
| Molecular Formula: | C25 H23 N3 O6 S |
| Smiles: | CCS(c1ccc(c(c1)NC(/C=C/c1ccccc1)=O)OCC1=CC(N2C(C=C(C)O2)=N1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3915 |
| logD: | 2.3894 |
| logSw: | -3.0134 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 97.232 |
| InChI Key: | QTEXVWDCTBSUBT-UHFFFAOYSA-N |