N-(3-ethoxypropyl)-3,6-dimethyl[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-(3-ethoxypropyl)-3,6-dimethyl[1,2]oxazolo[5,4-d]pyrimidin-4-amine
N-(3-ethoxypropyl)-3,6-dimethyl[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | F173-0507 |
| Compound Name: | N-(3-ethoxypropyl)-3,6-dimethyl[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| Molecular Weight: | 250.3 |
| Molecular Formula: | C12 H18 N4 O2 |
| Smiles: | CCOCCCNc1c2c(C)noc2nc(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 1.7662 |
| logD: | 1.7652 |
| logSw: | -1.6864 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.566 |
| InChI Key: | XUVKYUHYDXPRLP-UHFFFAOYSA-N |