N-(4-chlorophenyl)-3-ethyl-6-methyl[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-(4-chlorophenyl)-3-ethyl-6-methyl[1,2]oxazolo[5,4-d]pyrimidin-4-amine
N-(4-chlorophenyl)-3-ethyl-6-methyl[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | F173-0734 |
| Compound Name: | N-(4-chlorophenyl)-3-ethyl-6-methyl[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| Molecular Weight: | 288.73 |
| Molecular Formula: | C14 H13 Cl N4 O |
| Smiles: | CCc1c2c(Nc3ccc(cc3)[Cl])nc(C)nc2on1 |
| Stereo: | ACHIRAL |
| logP: | 3.8565 |
| logD: | 3.8565 |
| logSw: | -4.3438 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.842 |
| InChI Key: | QLGHGFDQKGTCMI-UHFFFAOYSA-N |