N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylbenzene-1-sulfonamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | F176-0439 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylbenzene-1-sulfonamide |
| Molecular Weight: | 430.52 |
| Molecular Formula: | C22 H26 N2 O5 S |
| Smiles: | Cc1ccc(cc1S(NCCc1ccc(c(c1)OC)OC)(=O)=O)c1c(C)noc1C |
| Stereo: | ACHIRAL |
| logP: | 3.3751 |
| logD: | 3.3748 |
| logSw: | -3.8091 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.866 |
| InChI Key: | DKXFUZHPYYQSJL-UHFFFAOYSA-N |