(3,4-dihydroisoquinolin-2(1H)-yl)[2-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]methanone
Chemical Structure Depiction of
(3,4-dihydroisoquinolin-2(1H)-yl)[2-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]methanone
(3,4-dihydroisoquinolin-2(1H)-yl)[2-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]methanone
Compound characteristics
| Compound ID: | F177-0086 |
| Compound Name: | (3,4-dihydroisoquinolin-2(1H)-yl)[2-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]methanone |
| Molecular Weight: | 381.43 |
| Molecular Formula: | C24 H19 N3 O2 |
| Smiles: | C1CN(Cc2ccccc12)C(c1ccccc1c1nc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9124 |
| logD: | 4.9124 |
| logSw: | -4.9256 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.954 |
| InChI Key: | CQUGRSKQMRXQDP-UHFFFAOYSA-N |