2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylbenzamide
Chemical Structure Depiction of
2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylbenzamide
2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylbenzamide
Compound characteristics
| Compound ID: | F177-0854 |
| Compound Name: | 2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylbenzamide |
| Molecular Weight: | 313.74 |
| Molecular Formula: | C16 H12 Cl N3 O2 |
| Smiles: | CNC(c1ccccc1c1nc(c2ccc(cc2)[Cl])no1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5175 |
| logD: | 3.5175 |
| logSw: | -4.1608 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.479 |
| InChI Key: | OQKZDGIPJQJNJU-UHFFFAOYSA-N |