4-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2,5-dimethylphenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2,5-dimethylphenyl)benzene-1-sulfonamide
4-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2,5-dimethylphenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | F180-0092 |
| Compound Name: | 4-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2,5-dimethylphenyl)benzene-1-sulfonamide |
| Molecular Weight: | 356.44 |
| Molecular Formula: | C19 H20 N2 O3 S |
| Smiles: | Cc1ccc(C)c(c1)NS(c1ccc(cc1)c1c(C)noc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7813 |
| logD: | 3.7624 |
| logSw: | -4.2053 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.957 |
| InChI Key: | HNXUDUXAXAZFHH-UHFFFAOYSA-N |