N-(4-{[4-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1-sulfonyl]amino}phenyl)acetamide
Chemical Structure Depiction of
N-(4-{[4-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1-sulfonyl]amino}phenyl)acetamide
N-(4-{[4-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1-sulfonyl]amino}phenyl)acetamide
Compound characteristics
| Compound ID: | F180-0187 |
| Compound Name: | N-(4-{[4-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1-sulfonyl]amino}phenyl)acetamide |
| Molecular Weight: | 385.44 |
| Molecular Formula: | C19 H19 N3 O4 S |
| Smiles: | CC(Nc1ccc(cc1)NS(c1ccc(cc1)c1c(C)noc1C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6971 |
| logD: | 2.6759 |
| logSw: | -3.2973 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.917 |
| InChI Key: | ATAHQNSNQSSZBJ-UHFFFAOYSA-N |