N-{4-[2-(2-ethoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}benzamide
Chemical Structure Depiction of
N-{4-[2-(2-ethoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}benzamide
N-{4-[2-(2-ethoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}benzamide
Compound characteristics
| Compound ID: | F186-0083 |
| Compound Name: | N-{4-[2-(2-ethoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}benzamide |
| Molecular Weight: | 381.45 |
| Molecular Formula: | C20 H19 N3 O3 S |
| Smiles: | CCOc1ccccc1NC(Cc1csc(NC(c2ccccc2)=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8093 |
| logD: | 3.7417 |
| logSw: | -3.9722 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.262 |
| InChI Key: | DODYAYDPJKYPQH-UHFFFAOYSA-N |