4-chloro-N-[4-(2-{[(2,6-difluorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]benzamide
Chemical Structure Depiction of
4-chloro-N-[4-(2-{[(2,6-difluorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]benzamide
4-chloro-N-[4-(2-{[(2,6-difluorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]benzamide
Compound characteristics
| Compound ID: | F186-0295 |
| Compound Name: | 4-chloro-N-[4-(2-{[(2,6-difluorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]benzamide |
| Molecular Weight: | 421.85 |
| Molecular Formula: | C19 H14 Cl F2 N3 O2 S |
| Smiles: | C(C(NCc1c(cccc1F)F)=O)c1csc(NC(c2ccc(cc2)[Cl])=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.3622 |
| logD: | 3.9706 |
| logSw: | -4.8035 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.071 |
| InChI Key: | GIUFDSLJCMDUNE-UHFFFAOYSA-N |