4-methoxy-N-{4-[2-(2-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}benzamide
Chemical Structure Depiction of
4-methoxy-N-{4-[2-(2-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}benzamide
4-methoxy-N-{4-[2-(2-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}benzamide
Compound characteristics
| Compound ID: | F186-0388 |
| Compound Name: | 4-methoxy-N-{4-[2-(2-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}benzamide |
| Molecular Weight: | 397.45 |
| Molecular Formula: | C20 H19 N3 O4 S |
| Smiles: | COc1ccc(cc1)C(Nc1nc(CC(Nc2ccccc2OC)=O)cs1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4752 |
| logD: | 3.4403 |
| logSw: | -3.8516 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.226 |
| InChI Key: | QDSHVTRBUMRQBR-UHFFFAOYSA-N |