N-{4-[2-(4-ethoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}-3,4-dimethoxybenzamide
Chemical Structure Depiction of
N-{4-[2-(4-ethoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}-3,4-dimethoxybenzamide
N-{4-[2-(4-ethoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}-3,4-dimethoxybenzamide
Compound characteristics
| Compound ID: | F186-0546 |
| Compound Name: | N-{4-[2-(4-ethoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl}-3,4-dimethoxybenzamide |
| Molecular Weight: | 441.5 |
| Molecular Formula: | C22 H23 N3 O5 S |
| Smiles: | CCOc1ccc(cc1)NC(Cc1csc(NC(c2ccc(c(c2)OC)OC)=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7329 |
| logD: | 3.724 |
| logSw: | -4.0686 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.133 |
| InChI Key: | CGXNBQYDLMSMPT-UHFFFAOYSA-N |