N-{4-[2-(butylamino)-2-oxoethyl]-1,3-thiazol-2-yl}furan-2-carboxamide
Chemical Structure Depiction of
N-{4-[2-(butylamino)-2-oxoethyl]-1,3-thiazol-2-yl}furan-2-carboxamide
N-{4-[2-(butylamino)-2-oxoethyl]-1,3-thiazol-2-yl}furan-2-carboxamide
Compound characteristics
| Compound ID: | F186-0954 |
| Compound Name: | N-{4-[2-(butylamino)-2-oxoethyl]-1,3-thiazol-2-yl}furan-2-carboxamide |
| Molecular Weight: | 307.37 |
| Molecular Formula: | C14 H17 N3 O3 S |
| Smiles: | CCCCNC(Cc1csc(NC(c2ccco2)=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3283 |
| logD: | 2.3031 |
| logSw: | -2.9496 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.763 |
| InChI Key: | OAMLMCNMDDEOBP-UHFFFAOYSA-N |