N-[4-(2-{[(2-chlorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]furan-2-carboxamide
Chemical Structure Depiction of
N-[4-(2-{[(2-chlorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]furan-2-carboxamide
N-[4-(2-{[(2-chlorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]furan-2-carboxamide
Compound characteristics
| Compound ID: | F186-0971 |
| Compound Name: | N-[4-(2-{[(2-chlorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]furan-2-carboxamide |
| Molecular Weight: | 375.83 |
| Molecular Formula: | C17 H14 Cl N3 O3 S |
| Smiles: | C(C(NCc1ccccc1[Cl])=O)c1csc(NC(c2ccco2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.4566 |
| logD: | 3.4314 |
| logSw: | -3.7283 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.65 |
| InChI Key: | OTROMLZLDKRDIA-UHFFFAOYSA-N |