N-(4-{2-[2-(methylsulfanyl)anilino]-2-oxoethyl}-1,3-thiazol-2-yl)furan-2-carboxamide
Chemical Structure Depiction of
N-(4-{2-[2-(methylsulfanyl)anilino]-2-oxoethyl}-1,3-thiazol-2-yl)furan-2-carboxamide
N-(4-{2-[2-(methylsulfanyl)anilino]-2-oxoethyl}-1,3-thiazol-2-yl)furan-2-carboxamide
Compound characteristics
| Compound ID: | F186-1014 |
| Compound Name: | N-(4-{2-[2-(methylsulfanyl)anilino]-2-oxoethyl}-1,3-thiazol-2-yl)furan-2-carboxamide |
| Molecular Weight: | 373.45 |
| Molecular Formula: | C17 H15 N3 O3 S2 |
| Smiles: | CSc1ccccc1NC(Cc1csc(NC(c2ccco2)=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0678 |
| logD: | 3.0426 |
| logSw: | -3.4075 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.63 |
| InChI Key: | USCPNLQMHBFHPF-UHFFFAOYSA-N |