N-[4-(2-{[(4-chlorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide
Chemical Structure Depiction of
N-[4-(2-{[(4-chlorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide
N-[4-(2-{[(4-chlorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide
Compound characteristics
| Compound ID: | F186-1298 |
| Compound Name: | N-[4-(2-{[(4-chlorophenyl)methyl]amino}-2-oxoethyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
| Molecular Weight: | 365.88 |
| Molecular Formula: | C17 H20 Cl N3 O2 S |
| Smiles: | CC(C)(C)C(Nc1nc(CC(NCc2ccc(cc2)[Cl])=O)cs1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5879 |
| logD: | 3.5807 |
| logSw: | -4.0418 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.343 |
| InChI Key: | LQJWAMUUPAUZGK-UHFFFAOYSA-N |