5-amino-4-(1,3-benzothiazol-2-yl)-1-({4-[(propan-2-yl)oxy]phenyl}methyl)-1,2-dihydro-3H-pyrrol-3-one
Chemical Structure Depiction of
5-amino-4-(1,3-benzothiazol-2-yl)-1-({4-[(propan-2-yl)oxy]phenyl}methyl)-1,2-dihydro-3H-pyrrol-3-one
5-amino-4-(1,3-benzothiazol-2-yl)-1-({4-[(propan-2-yl)oxy]phenyl}methyl)-1,2-dihydro-3H-pyrrol-3-one
Compound characteristics
| Compound ID: | F187-0270 |
| Compound Name: | 5-amino-4-(1,3-benzothiazol-2-yl)-1-({4-[(propan-2-yl)oxy]phenyl}methyl)-1,2-dihydro-3H-pyrrol-3-one |
| Molecular Weight: | 379.48 |
| Molecular Formula: | C21 H21 N3 O2 S |
| Smiles: | CC(C)Oc1ccc(CN2CC(C(=C2N)c2nc3ccccc3s2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.7739 |
| logD: | 3.7739 |
| logSw: | -4.045 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.668 |
| InChI Key: | OBXLZDGEQKRDTL-UHFFFAOYSA-N |