2-methoxy-5-methyl-N-[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]benzene-1-sulfonamide
Chemical Structure Depiction of
2-methoxy-5-methyl-N-[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]benzene-1-sulfonamide
2-methoxy-5-methyl-N-[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | F215-0315 |
| Compound Name: | 2-methoxy-5-methyl-N-[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]benzene-1-sulfonamide |
| Molecular Weight: | 408.48 |
| Molecular Formula: | C21 H20 N4 O3 S |
| Smiles: | Cc1ccc(c(c1)S(Nc1ccc(cc1)c1cn2ccc(C)nc2n1)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.7156 |
| logD: | 3.7039 |
| logSw: | -3.8351 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.764 |
| InChI Key: | MOQVRRRRCRUAOH-UHFFFAOYSA-N |