methyl 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-6,7-dimethylquinoxaline-2-carboxylate
Chemical Structure Depiction of
methyl 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-6,7-dimethylquinoxaline-2-carboxylate
methyl 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-6,7-dimethylquinoxaline-2-carboxylate
Compound characteristics
| Compound ID: | F218-0984 |
| Compound Name: | methyl 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-6,7-dimethylquinoxaline-2-carboxylate |
| Molecular Weight: | 424.93 |
| Molecular Formula: | C23 H25 Cl N4 O2 |
| Smiles: | Cc1cc2c(cc1C)nc(c(C(=O)OC)n2)N1CCN(CC1)c1cc(ccc1C)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.2868 |
| logD: | 6.2868 |
| logSw: | -6.1244 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.461 |
| InChI Key: | VKQWYVBFEMEHBL-UHFFFAOYSA-N |