ethyl 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-6,7-dimethylquinoxaline-2-carboxylate
Chemical Structure Depiction of
ethyl 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-6,7-dimethylquinoxaline-2-carboxylate
ethyl 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-6,7-dimethylquinoxaline-2-carboxylate
Compound characteristics
| Compound ID: | F218-1302 |
| Compound Name: | ethyl 3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-6,7-dimethylquinoxaline-2-carboxylate |
| Molecular Weight: | 438.96 |
| Molecular Formula: | C24 H27 Cl N4 O2 |
| Smiles: | CCOC(c1c(nc2cc(C)c(C)cc2n1)N1CCN(CC1)c1cc(ccc1C)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.6368 |
| logD: | 6.6368 |
| logSw: | -6.1718 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.04 |
| InChI Key: | MMWAPRKNSFNBGS-UHFFFAOYSA-N |