2-methylpropyl 3-(3-methylanilino)quinoxaline-2-carboxylate
Chemical Structure Depiction of
2-methylpropyl 3-(3-methylanilino)quinoxaline-2-carboxylate
2-methylpropyl 3-(3-methylanilino)quinoxaline-2-carboxylate
Compound characteristics
| Compound ID: | F218-8443 |
| Compound Name: | 2-methylpropyl 3-(3-methylanilino)quinoxaline-2-carboxylate |
| Molecular Weight: | 335.4 |
| Molecular Formula: | C20 H21 N3 O2 |
| Smiles: | CC(C)COC(c1c(Nc2cccc(C)c2)nc2ccccc2n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9997 |
| logD: | 4.9997 |
| logSw: | -4.6458 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.623 |
| InChI Key: | ULEIRQRZZSLDPQ-UHFFFAOYSA-N |