N-{6-[2-(4-methoxyanilino)-2-oxoethyl]-1,3-benzothiazol-2-yl}-2-methylpropanamide
					Chemical Structure Depiction of
N-{6-[2-(4-methoxyanilino)-2-oxoethyl]-1,3-benzothiazol-2-yl}-2-methylpropanamide
			N-{6-[2-(4-methoxyanilino)-2-oxoethyl]-1,3-benzothiazol-2-yl}-2-methylpropanamide
Compound characteristics
| Compound ID: | F223-1179 | 
| Compound Name: | N-{6-[2-(4-methoxyanilino)-2-oxoethyl]-1,3-benzothiazol-2-yl}-2-methylpropanamide | 
| Molecular Weight: | 383.47 | 
| Molecular Formula: | C20 H21 N3 O3 S | 
| Smiles: | CC(C)C(Nc1nc2ccc(CC(Nc3ccc(cc3)OC)=O)cc2s1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.0601 | 
| logD: | 4.06 | 
| logSw: | -4.2254 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 63.784 | 
| InChI Key: | ZWMXLMKOEUGWCT-UHFFFAOYSA-N | 
 
				 
				