N-(4-bromo-2-methylphenyl)-1-(2,5,6-trimethylfuro[2,3-d]pyrimidin-4-yl)piperidine-3-carboxamide
Chemical Structure Depiction of
N-(4-bromo-2-methylphenyl)-1-(2,5,6-trimethylfuro[2,3-d]pyrimidin-4-yl)piperidine-3-carboxamide
N-(4-bromo-2-methylphenyl)-1-(2,5,6-trimethylfuro[2,3-d]pyrimidin-4-yl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | F228-0954 |
| Compound Name: | N-(4-bromo-2-methylphenyl)-1-(2,5,6-trimethylfuro[2,3-d]pyrimidin-4-yl)piperidine-3-carboxamide |
| Molecular Weight: | 457.37 |
| Molecular Formula: | C22 H25 Br N4 O2 |
| Smiles: | Cc1cc(ccc1NC(C1CCCN(C1)c1c2c(C)c(C)oc2nc(C)n1)=O)[Br] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5965 |
| logD: | 4.2594 |
| logSw: | -4.5233 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.255 |
| InChI Key: | SGFXTBWPIXLZRZ-INIZCTEOSA-N |