3-hydroxy-5-(4-methoxyphenyl)-4-(4-methylbenzene-1-sulfonyl)-1-phenyl-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
3-hydroxy-5-(4-methoxyphenyl)-4-(4-methylbenzene-1-sulfonyl)-1-phenyl-1,5-dihydro-2H-pyrrol-2-one
3-hydroxy-5-(4-methoxyphenyl)-4-(4-methylbenzene-1-sulfonyl)-1-phenyl-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | F232-0905 |
| Compound Name: | 3-hydroxy-5-(4-methoxyphenyl)-4-(4-methylbenzene-1-sulfonyl)-1-phenyl-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 435.5 |
| Molecular Formula: | C24 H21 N O5 S |
| Smiles: | Cc1ccc(cc1)S(C1C(c2ccc(cc2)OC)N(C(C=1O)=O)c1ccccc1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.128 |
| logD: | 4.1168 |
| logSw: | -4.128 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.793 |
| InChI Key: | WOCSPRCYWOTTCG-OAQYLSRUSA-N |