5-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]-3-hydroxy-4-(4-methylbenzene-1-sulfonyl)-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
5-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]-3-hydroxy-4-(4-methylbenzene-1-sulfonyl)-1,5-dihydro-2H-pyrrol-2-one
5-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]-3-hydroxy-4-(4-methylbenzene-1-sulfonyl)-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | F232-1310 |
| Compound Name: | 5-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]-3-hydroxy-4-(4-methylbenzene-1-sulfonyl)-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 455.48 |
| Molecular Formula: | C24 H19 F2 N O4 S |
| Smiles: | Cc1ccc(cc1)S(C1C(c2ccc(cc2)F)N(Cc2ccc(cc2)F)C(C=1O)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3511 |
| logD: | 4.3192 |
| logSw: | -4.2083 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.861 |
| InChI Key: | GPFAJIKYBGXWKQ-OAQYLSRUSA-N |