1-[1-(pyridin-3-yl)-1H-pyrrole-2-carbonyl]-N-[2-(thiophen-2-yl)ethyl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-[1-(pyridin-3-yl)-1H-pyrrole-2-carbonyl]-N-[2-(thiophen-2-yl)ethyl]piperidine-4-carboxamide
1-[1-(pyridin-3-yl)-1H-pyrrole-2-carbonyl]-N-[2-(thiophen-2-yl)ethyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F234-0451 |
| Compound Name: | 1-[1-(pyridin-3-yl)-1H-pyrrole-2-carbonyl]-N-[2-(thiophen-2-yl)ethyl]piperidine-4-carboxamide |
| Molecular Weight: | 408.52 |
| Molecular Formula: | C22 H24 N4 O2 S |
| Smiles: | C1CN(CCC1C(NCCc1cccs1)=O)C(c1cccn1c1cccnc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4537 |
| logD: | 2.4537 |
| logSw: | -2.2176 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.726 |
| InChI Key: | DUTXAZYODMYIMK-UHFFFAOYSA-N |