2-chloro-N-(3-methylphenyl)-5-(piperidine-1-sulfonyl)benzamide
Chemical Structure Depiction of
2-chloro-N-(3-methylphenyl)-5-(piperidine-1-sulfonyl)benzamide
2-chloro-N-(3-methylphenyl)-5-(piperidine-1-sulfonyl)benzamide
Compound characteristics
| Compound ID: | F235-0710 |
| Compound Name: | 2-chloro-N-(3-methylphenyl)-5-(piperidine-1-sulfonyl)benzamide |
| Molecular Weight: | 392.9 |
| Molecular Formula: | C19 H21 Cl N2 O3 S |
| Smiles: | Cc1cccc(c1)NC(c1cc(ccc1[Cl])S(N1CCCCC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2551 |
| logD: | 4.2533 |
| logSw: | -4.5552 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.041 |
| InChI Key: | ZZFKVWQTJKQCNT-UHFFFAOYSA-N |