[4-(4-chloroanilino)-2-methyl-3,4-dihydroquinolin-1(2H)-yl](phenyl)methanone
Chemical Structure Depiction of
[4-(4-chloroanilino)-2-methyl-3,4-dihydroquinolin-1(2H)-yl](phenyl)methanone
[4-(4-chloroanilino)-2-methyl-3,4-dihydroquinolin-1(2H)-yl](phenyl)methanone
Compound characteristics
| Compound ID: | F235-0814 |
| Compound Name: | [4-(4-chloroanilino)-2-methyl-3,4-dihydroquinolin-1(2H)-yl](phenyl)methanone |
| Molecular Weight: | 376.88 |
| Molecular Formula: | C23 H21 Cl N2 O |
| Smiles: | CC1CC(c2ccccc2N1C(c1ccccc1)=O)Nc1ccc(cc1)[Cl] |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.2944 |
| logD: | 5.2944 |
| logSw: | -5.9482 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.6479 |
| InChI Key: | WKCOCBOPMVHBOR-UHFFFAOYSA-N |