3-benzamido-5-methoxy-N-[(3-methylphenyl)methyl]-1H-indole-2-carboxamide
Chemical Structure Depiction of
3-benzamido-5-methoxy-N-[(3-methylphenyl)methyl]-1H-indole-2-carboxamide
3-benzamido-5-methoxy-N-[(3-methylphenyl)methyl]-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | F252-1293 |
| Compound Name: | 3-benzamido-5-methoxy-N-[(3-methylphenyl)methyl]-1H-indole-2-carboxamide |
| Molecular Weight: | 413.48 |
| Molecular Formula: | C25 H23 N3 O3 |
| Smiles: | Cc1cccc(CNC(c2c(c3cc(ccc3[nH]2)OC)NC(c2ccccc2)=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.8473 |
| logD: | 3.8426 |
| logSw: | -4.1883 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 64.011 |
| InChI Key: | GLKFVXDBNTUFIN-UHFFFAOYSA-N |