3-benzamido-N-[(3,4-dimethoxyphenyl)methyl]-5-methoxy-1H-indole-2-carboxamide
Chemical Structure Depiction of
3-benzamido-N-[(3,4-dimethoxyphenyl)methyl]-5-methoxy-1H-indole-2-carboxamide
3-benzamido-N-[(3,4-dimethoxyphenyl)methyl]-5-methoxy-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | F252-1402 |
| Compound Name: | 3-benzamido-N-[(3,4-dimethoxyphenyl)methyl]-5-methoxy-1H-indole-2-carboxamide |
| Molecular Weight: | 459.5 |
| Molecular Formula: | C26 H25 N3 O5 |
| Smiles: | COc1ccc2c(c1)c(c(C(NCc1ccc(c(c1)OC)OC)=O)[nH]2)NC(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7737 |
| logD: | 2.769 |
| logSw: | -3.3222 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 79.271 |
| InChI Key: | RAIIRNQRPYUEEK-UHFFFAOYSA-N |