N-(2-ethoxyphenyl)-7-(4-fluorophenyl)-2,5,6-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-7-(4-fluorophenyl)-2,5,6-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
N-(2-ethoxyphenyl)-7-(4-fluorophenyl)-2,5,6-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | F254-3502 |
| Compound Name: | N-(2-ethoxyphenyl)-7-(4-fluorophenyl)-2,5,6-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Molecular Weight: | 390.46 |
| Molecular Formula: | C23 H23 F N4 O |
| Smiles: | CCOc1ccccc1Nc1c2c(C)c(C)n(c3ccc(cc3)F)c2nc(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.5847 |
| logD: | 4.6156 |
| logSw: | -5.8615 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.29 |
| InChI Key: | GILYLIOKUSGNPS-UHFFFAOYSA-N |