N'-(butan-2-yl)-N-(2-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}ethyl)-N-methylurea
Chemical Structure Depiction of
N'-(butan-2-yl)-N-(2-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}ethyl)-N-methylurea
N'-(butan-2-yl)-N-(2-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}ethyl)-N-methylurea
Compound characteristics
| Compound ID: | F256-1660 |
| Compound Name: | N'-(butan-2-yl)-N-(2-{5-[(4-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}ethyl)-N-methylurea |
| Molecular Weight: | 350.39 |
| Molecular Formula: | C17 H23 F N4 O3 |
| Smiles: | CCC(C)NC(N(C)CCc1nc(COc2ccc(cc2)F)on1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7716 |
| logD: | 2.7716 |
| logSw: | -3.1438 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.056 |
| InChI Key: | DZWSZBPCXGGBTE-LBPRGKRZSA-N |