N-{2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethyl}-3,4,5-trimethoxy-N-methylbenzamide
Chemical Structure Depiction of
N-{2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethyl}-3,4,5-trimethoxy-N-methylbenzamide
N-{2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethyl}-3,4,5-trimethoxy-N-methylbenzamide
Compound characteristics
| Compound ID: | F257-0740 |
| Compound Name: | N-{2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethyl}-3,4,5-trimethoxy-N-methylbenzamide |
| Molecular Weight: | 415.42 |
| Molecular Formula: | C21 H22 F N3 O5 |
| Smiles: | CN(CCc1nc(c2ccccc2F)on1)C(c1cc(c(c(c1)OC)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.546 |
| logD: | 2.546 |
| logSw: | -3.028 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 72.013 |
| InChI Key: | KEYPGCOBYSHLBB-UHFFFAOYSA-N |