3-fluoro-N-methyl-N-{2-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzamide
					Chemical Structure Depiction of
3-fluoro-N-methyl-N-{2-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzamide
			3-fluoro-N-methyl-N-{2-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzamide
Compound characteristics
| Compound ID: | F257-0954 | 
| Compound Name: | 3-fluoro-N-methyl-N-{2-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzamide | 
| Molecular Weight: | 339.37 | 
| Molecular Formula: | C19 H18 F N3 O2 | 
| Smiles: | Cc1cccc(c1)c1nc(CCN(C)C(c2cccc(c2)F)=O)no1 | 
| Stereo: | ACHIRAL | 
| logP: | 3.2937 | 
| logD: | 3.2937 | 
| logSw: | -3.3672 | 
| Hydrogen bond acceptors count: | 5 | 
| Polar surface area: | 49.035 | 
| InChI Key: | ALQMQGJRJFEENL-UHFFFAOYSA-N | 
 
				 
				