4-tert-butyl-N-(2-{5-[(2-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}ethyl)-N-methylbenzamide
Chemical Structure Depiction of
4-tert-butyl-N-(2-{5-[(2-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}ethyl)-N-methylbenzamide
4-tert-butyl-N-(2-{5-[(2-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}ethyl)-N-methylbenzamide
Compound characteristics
| Compound ID: | F257-1932 |
| Compound Name: | 4-tert-butyl-N-(2-{5-[(2-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}ethyl)-N-methylbenzamide |
| Molecular Weight: | 411.48 |
| Molecular Formula: | C23 H26 F N3 O3 |
| Smiles: | CC(C)(C)c1ccc(cc1)C(N(C)CCc1nc(COc2ccccc2F)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6352 |
| logD: | 4.6352 |
| logSw: | -4.4427 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.287 |
| InChI Key: | BHZKYLWHFDLRDY-UHFFFAOYSA-N |