N-[2-(5-cyclohexyl-1,2,4-oxadiazol-3-yl)ethyl]-4-methoxy-N-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-[2-(5-cyclohexyl-1,2,4-oxadiazol-3-yl)ethyl]-4-methoxy-N-methylbenzene-1-sulfonamide
N-[2-(5-cyclohexyl-1,2,4-oxadiazol-3-yl)ethyl]-4-methoxy-N-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | F258-0009 |
| Compound Name: | N-[2-(5-cyclohexyl-1,2,4-oxadiazol-3-yl)ethyl]-4-methoxy-N-methylbenzene-1-sulfonamide |
| Molecular Weight: | 379.48 |
| Molecular Formula: | C18 H25 N3 O4 S |
| Smiles: | CN(CCc1nc(C2CCCCC2)on1)S(c1ccc(cc1)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9464 |
| logD: | 3.9464 |
| logSw: | -3.953 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 73.185 |
| InChI Key: | WTWNZLOLCQSDFF-UHFFFAOYSA-N |