N,4-dimethyl-N-{2-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzene-1-sulfonamide
Chemical Structure Depiction of
N,4-dimethyl-N-{2-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzene-1-sulfonamide
N,4-dimethyl-N-{2-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | F258-0156 |
| Compound Name: | N,4-dimethyl-N-{2-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzene-1-sulfonamide |
| Molecular Weight: | 371.46 |
| Molecular Formula: | C19 H21 N3 O3 S |
| Smiles: | Cc1ccc(cc1)c1nc(CCN(C)S(c2ccc(C)cc2)(=O)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.2625 |
| logD: | 4.2625 |
| logSw: | -4.1862 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 65.449 |
| InChI Key: | KJIXQDOKGVMKRK-UHFFFAOYSA-N |