2,5-dimethoxy-N-methyl-N-{2-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzene-1-sulfonamide
Chemical Structure Depiction of
2,5-dimethoxy-N-methyl-N-{2-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzene-1-sulfonamide
2,5-dimethoxy-N-methyl-N-{2-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | F258-0190 |
| Compound Name: | 2,5-dimethoxy-N-methyl-N-{2-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}benzene-1-sulfonamide |
| Molecular Weight: | 417.48 |
| Molecular Formula: | C20 H23 N3 O5 S |
| Smiles: | Cc1ccc(cc1)c1nc(CCN(C)S(c2cc(ccc2OC)OC)(=O)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.6562 |
| logD: | 3.6562 |
| logSw: | -3.8707 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 80.623 |
| InChI Key: | KRNXDWVRPMLLBS-UHFFFAOYSA-N |