N,3,5-trimethyl-N-{2-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}-1,2-oxazole-4-sulfonamide
Chemical Structure Depiction of
N,3,5-trimethyl-N-{2-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}-1,2-oxazole-4-sulfonamide
N,3,5-trimethyl-N-{2-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}-1,2-oxazole-4-sulfonamide
Compound characteristics
| Compound ID: | F258-0542 |
| Compound Name: | N,3,5-trimethyl-N-{2-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]ethyl}-1,2-oxazole-4-sulfonamide |
| Molecular Weight: | 376.43 |
| Molecular Formula: | C17 H20 N4 O4 S |
| Smiles: | Cc1cccc(c1)c1nc(CCN(C)S(c2c(C)noc2C)(=O)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 2.4107 |
| logD: | 2.4107 |
| logSw: | -2.6825 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 87.487 |
| InChI Key: | YWWDHLNQNAXHHZ-UHFFFAOYSA-N |