N-{2-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethyl}-N-methyl-4-propylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-{2-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethyl}-N-methyl-4-propylbenzene-1-sulfonamide
N-{2-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethyl}-N-methyl-4-propylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | F258-0858 |
| Compound Name: | N-{2-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethyl}-N-methyl-4-propylbenzene-1-sulfonamide |
| Molecular Weight: | 403.47 |
| Molecular Formula: | C20 H22 F N3 O3 S |
| Smiles: | CCCc1ccc(cc1)S(N(C)CCc1nc(c2ccc(cc2)F)on1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8501 |
| logD: | 4.8501 |
| logSw: | -4.5584 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 65.449 |
| InChI Key: | IJEDKAODPRVMAP-UHFFFAOYSA-N |