N-(2-acetamido-1,3-benzothiazol-6-yl)-2-phenylbutanamide
Chemical Structure Depiction of
N-(2-acetamido-1,3-benzothiazol-6-yl)-2-phenylbutanamide
N-(2-acetamido-1,3-benzothiazol-6-yl)-2-phenylbutanamide
Compound characteristics
| Compound ID: | F259-0173 |
| Compound Name: | N-(2-acetamido-1,3-benzothiazol-6-yl)-2-phenylbutanamide |
| Molecular Weight: | 353.44 |
| Molecular Formula: | C19 H19 N3 O2 S |
| Smiles: | CCC(C(Nc1ccc2c(c1)sc(NC(C)=O)n2)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1845 |
| logD: | 4.1842 |
| logSw: | -4.1773 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.353 |
| InChI Key: | KBDXOSACKLYIBK-OAHLLOKOSA-N |